C13H31BCl2N2O5 — CID 87173214
2-amino-6-borono-2-[[(1-hydroxy-4-methylpentan-2-yl)amino]methyl]hexanoic acid;dihydrochloride (PubChem CID 87173214) has the molecular formula C13H31BCl2N2O5 and a molecular weight of 377.12 g/mol. Its IUPAC name is 2-amino-6-borono-2-[[(1-hydroxy-4-methylpentan-2-yl)amino]methyl]hexanoic acid;dihydrochloride.
| Compound Name | 2-amino-6-borono-2-[[(1-hydroxy-4-methylpentan-2-yl)amino]methyl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 87173214 |
| Molecular Formula | C13H31BCl2N2O5 |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-amino-6-borono-2-[[(1-hydroxy-4-methylpentan-2-yl)amino]methyl]hexanoic acid;dihydrochloride |
| SMILES | CC(C)CC(CO)NCC(N)(CCCCB(O)O)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C13H29BN2O5.2ClH/c1-10(2)7-11(8-17)16-9-13(15,12(18)19)5-3-4-6-14(20)21;;/h10-11,16-17,20-21H,3-9,15H2,1-2H3,(H,18,19);2*1H |
| InChIKey | GXIJTESESWJYME-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|