C21H29BN2O5 — CID 66833318
2-amino-6-borono-2-[[(2-hydroxy-1,2-diphenylethyl)amino]methyl]hexanoic acid (PubChem CID 66833318) has the molecular formula C21H29BN2O5 and a molecular weight of 400.28 g/mol. Its IUPAC name is 2-amino-6-borono-2-[[(2-hydroxy-1,2-diphenylethyl)amino]methyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[[(2-hydroxy-1,2-diphenylethyl)amino]methyl]hexanoic acid |
|---|---|
| PubChem CID | 66833318 |
| Molecular Formula | C21H29BN2O5 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-amino-6-borono-2-[[(2-hydroxy-1,2-diphenylethyl)amino]methyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(CNC(c1ccccc1)C(O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H29BN2O5/c23-21(20(26)27,13-7-8-14-22(28)29)15-24-18(16-9-3-1-4-10-16)19(25)17-11-5-2-6-12-17/h1-6,9-12,18-19,24-25,28-29H,7-8,13-15,23H2,(H,26,27) |
| InChIKey | NFRVDVCIAHFLRG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|