C18H33BCl2N2O5 — CID 174680255
2-amino-6-borono-2-[2-[2-hydroxyethyl(2-phenylethyl)amino]ethyl]hexanoic acid;dihydrochloride (PubChem CID 174680255) has the molecular formula C18H33BCl2N2O5 and a molecular weight of 439.19 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-[2-hydroxyethyl(2-phenylethyl)amino]ethyl]hexanoic acid;dihydrochloride.
| Compound Name | 2-amino-6-borono-2-[2-[2-hydroxyethyl(2-phenylethyl)amino]ethyl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 174680255 |
| Molecular Formula | C18H33BCl2N2O5 |
| Molecular Weight | 439.19 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-amino-6-borono-2-[2-[2-hydroxyethyl(2-phenylethyl)amino]ethyl]hexanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(CCCCB(O)O)(CCN(CCO)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H31BN2O5.2ClH/c20-18(17(23)24,9-4-5-11-19(25)26)10-13-21(14-15-22)12-8-16-6-2-1-3-7-16;;/h1-3,6-7,22,25-26H,4-5,8-15,20H2,(H,23,24);2*1H |
| InChIKey | SEKYOJHTKWQMCV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|