C21H33BN2O2 — CID 145219499
(5,6-diamino-5-methylhexyl)boronic acid;2-phenylethylbenzene (PubChem CID 145219499) has the molecular formula C21H33BN2O2 and a molecular weight of 356.32 g/mol. Its IUPAC name is (5,6-diamino-5-methylhexyl)boronic acid;2-phenylethylbenzene.
| Compound Name | (5,6-diamino-5-methylhexyl)boronic acid;2-phenylethylbenzene |
|---|---|
| PubChem CID | 145219499 |
| Molecular Formula | C21H33BN2O2 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (5,6-diamino-5-methylhexyl)boronic acid;2-phenylethylbenzene |
| SMILES | CC(N)(CN)CCCCB(O)O.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C7H19BN2O2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-7(10,6-9)4-2-3-5-8(11)12/h1-10H,11-12H2;11-12H,2-6,9-10H2,1H3 |
| InChIKey | IJLWFIWUYLPPOA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|