About (5-amino-9-phenylnonyl)boronic acid;carbon dioxide
(5-amino-9-phenylnonyl)boronic acid;carbon dioxide (PubChem CID 158139635) has the molecular formula C16H26BNO4
and a molecular weight of 307.20 g/mol. Its IUPAC name is (5-amino-9-phenylnonyl)boronic acid;carbon dioxide.
Molecular Properties
| Compound Name | (5-amino-9-phenylnonyl)boronic acid;carbon dioxide |
| PubChem CID | 158139635 |
| Molecular Formula | C16H26BNO4 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (5-amino-9-phenylnonyl)boronic acid;carbon dioxide |
| SMILES | NC(CCCCB(O)O)CCCCc1ccccc1.O=C=O |
| InChI | InChI=1S/C15H26BNO2.CO2/c17-15(12-6-7-13-16(18)19)11-5-4-10-14-8-2-1-3-9-14;2-1-3/h1-3,8-9,15,18-19H,4-7,10-13,17H2; |
| InChIKey | FTTXMYHSTBNMNV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-9-phenylnonyl)boronic acid;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-9-phenylnonyl)boronic acid;carbon dioxide?
The IUPAC name of (5-amino-9-phenylnonyl)boronic acid;carbon dioxide (CID 158139635) is (5-amino-9-phenylnonyl)boronic acid;carbon dioxide.
What is the SMILES notation for (5-amino-9-phenylnonyl)boronic acid;carbon dioxide?
The canonical SMILES for (5-amino-9-phenylnonyl)boronic acid;carbon dioxide is NC(CCCCB(O)O)CCCCc1ccccc1.O=C=O.
What is the InChIKey of (5-amino-9-phenylnonyl)boronic acid;carbon dioxide?
The InChIKey is FTTXMYHSTBNMNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26BNO2.CO2/c17-15(12-6-7-13-16(18)19)11-5-4-10-14-8-2-1-3-9-14;2-1-3/h1-3,8-9,15,18-19H,4-7,10-13,17H2;.
What are the key properties of (5-amino-9-phenylnonyl)boronic acid;carbon dioxide?
(5-amino-9-phenylnonyl)boronic acid;carbon dioxide has a molecular weight of 307.20 g/mol, XLogP of 1.79, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-9-phenylnonyl)boronic acid;carbon dioxide is sourced from PubChem (CID 158139635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).