C13H22N2 — CID 174860311
7-phenylheptane-1,4-diamine (PubChem CID 174860311) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 7-phenylheptane-1,4-diamine.
| Compound Name | 7-phenylheptane-1,4-diamine |
|---|---|
| PubChem CID | 174860311 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 7-phenylheptane-1,4-diamine |
| SMILES | NCCCC(N)CCCc1ccccc1 |
| InChI | InChI=1S/C13H22N2/c14-11-5-10-13(15)9-4-8-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11,14-15H2 |
| InChIKey | WKAQIDAVGSKUQK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |