C11H18N2 — CID 68702978
5-phenylpentane-1,3-diamine (PubChem CID 68702978) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 5-phenylpentane-1,3-diamine.
| Compound Name | 5-phenylpentane-1,3-diamine |
|---|---|
| PubChem CID | 68702978 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 5-phenylpentane-1,3-diamine |
| SMILES | NCCC(N)CCc1ccccc1 |
| InChI | InChI=1S/C11H18N2/c12-9-8-11(13)7-6-10-4-2-1-3-5-10/h1-5,11H,6-9,12-13H2 |
| InChIKey | UVVKLTSZOIVPHI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |