C19H26N2 — CID 126603451
(2S,5R)-1,7-diphenylheptane-2,5-diamine (PubChem CID 126603451) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (2S,5R)-1,7-diphenylheptane-2,5-diamine.
| Compound Name | (2S,5R)-1,7-diphenylheptane-2,5-diamine |
|---|---|
| PubChem CID | 126603451 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (2S,5R)-1,7-diphenylheptane-2,5-diamine |
| SMILES | N[C@H](CCc1ccccc1)CC[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2/c20-18(12-11-16-7-3-1-4-8-16)13-14-19(21)15-17-9-5-2-6-10-17/h1-10,18-19H,11-15,20-21H2/t18-,19+/m1/s1 |
| InChIKey | IJKRJTOFDCTGSB-MOPGFXCFSA-N |
| XLogP | 3.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |