C19H28N2 — CID 160625551
(2R,5R)-1,6-diphenylhexane-2,5-diamine;methane (PubChem CID 160625551) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is (2R,5R)-1,6-diphenylhexane-2,5-diamine;methane.
| Compound Name | (2R,5R)-1,6-diphenylhexane-2,5-diamine;methane |
|---|---|
| PubChem CID | 160625551 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (2R,5R)-1,6-diphenylhexane-2,5-diamine;methane |
| SMILES | C.N[C@H](CC[C@@H](N)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2.CH4/c19-17(13-15-7-3-1-4-8-15)11-12-18(20)14-16-9-5-2-6-10-16;/h1-10,17-18H,11-14,19-20H2;1H4/t17-,18-;/m1./s1 |
| InChIKey | RHGGOIZJLCQJDS-JAXOOIEVSA-N |
| XLogP | 3.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |