C12H18N2 — CID 146226437
(5S)-6-phenylhex-1-ene-2,5-diamine (PubChem CID 146226437) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (5S)-6-phenylhex-1-ene-2,5-diamine.
| Compound Name | (5S)-6-phenylhex-1-ene-2,5-diamine |
|---|---|
| PubChem CID | 146226437 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (5S)-6-phenylhex-1-ene-2,5-diamine |
| SMILES | C=C(N)CC[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C12H18N2/c1-10(13)7-8-12(14)9-11-5-3-2-4-6-11/h2-6,12H,1,7-9,13-14H2/t12-/m0/s1 |
| InChIKey | IGNILIDGUMFTMQ-LBPRGKRZSA-N |
| XLogP | 1.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |