C11H18N2 — CID 175295695
ethene;3-phenylpropane-1,2-diamine (PubChem CID 175295695) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is ethene;3-phenylpropane-1,2-diamine.
| Compound Name | ethene;3-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 175295695 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethene;3-phenylpropane-1,2-diamine |
| SMILES | C=C.NCC(N)Cc1ccccc1 |
| InChI | InChI=1S/C9H14N2.C2H4/c10-7-9(11)6-8-4-2-1-3-5-8;1-2/h1-5,9H,6-7,10-11H2;1-2H2 |
| InChIKey | YLCOHHYJOLSXEQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|