C10H16N2O — CID 66646271
3,4-diamino-1-phenylbutan-2-ol (PubChem CID 66646271) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3,4-diamino-1-phenylbutan-2-ol.
| Compound Name | 3,4-diamino-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 66646271 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3,4-diamino-1-phenylbutan-2-ol |
| SMILES | NCC(N)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C10H16N2O/c11-7-9(12)10(13)6-8-4-2-1-3-5-8/h1-5,9-10,13H,6-7,11-12H2 |
| InChIKey | PWYPCIBTVJCYFC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |