C10H14ClNO — CID 89399982
(2R,3R)-3-amino-1-chloro-4-phenylbutan-2-ol (PubChem CID 89399982) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is (2R,3R)-3-amino-1-chloro-4-phenylbutan-2-ol.
| Compound Name | (2R,3R)-3-amino-1-chloro-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 89399982 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (2R,3R)-3-amino-1-chloro-4-phenylbutan-2-ol |
| SMILES | N[C@H](Cc1ccccc1)[C@@H](O)CCl |
| InChI | InChI=1S/C10H14ClNO/c11-7-10(13)9(12)6-8-4-2-1-3-5-8/h1-5,9-10,13H,6-7,12H2/t9-,10+/m1/s1 |
| InChIKey | YXWOYBQZWSLSMU-ZJUUUORDSA-N |
| XLogP | 1.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|