C16H19ClN2O — CID 69147350
(2R,3S)-3-amino-1-(2-chloroanilino)-4-phenylbutan-2-ol (PubChem CID 69147350) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-(2-chloroanilino)-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-(2-chloroanilino)-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 69147350 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (2R,3S)-3-amino-1-(2-chloroanilino)-4-phenylbutan-2-ol |
| SMILES | N[C@@H](Cc1ccccc1)[C@H](O)CNc1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN2O/c17-13-8-4-5-9-15(13)19-11-16(20)14(18)10-12-6-2-1-3-7-12/h1-9,14,16,19-20H,10-11,18H2/t14-,16+/m0/s1 |
| InChIKey | GYIIMQNPLQYKJB-GOEBONIOSA-N |
| XLogP | 2.68 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |