C17H21ClN2O — CID 68609022
(2R,3S)-3-amino-1-[(4-chlorophenyl)methylamino]-4-phenylbutan-2-ol (PubChem CID 68609022) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[(4-chlorophenyl)methylamino]-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[(4-chlorophenyl)methylamino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 68609022 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2R,3S)-3-amino-1-[(4-chlorophenyl)methylamino]-4-phenylbutan-2-ol |
| SMILES | N[C@@H](Cc1ccccc1)[C@H](O)CNCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O/c18-15-8-6-14(7-9-15)11-20-12-17(21)16(19)10-13-4-2-1-3-5-13/h1-9,16-17,20-21H,10-12,19H2/t16-,17+/m0/s1 |
| InChIKey | BZMCKLZQNFIHHU-DLBZAZTESA-N |
| XLogP | 2.36 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |