C16H21N3O — CID 68608574
(2R,3S)-3-amino-4-phenyl-1-(pyridin-2-ylmethylamino)butan-2-ol (PubChem CID 68608574) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-phenyl-1-(pyridin-2-ylmethylamino)butan-2-ol.
| Compound Name | (2R,3S)-3-amino-4-phenyl-1-(pyridin-2-ylmethylamino)butan-2-ol |
|---|---|
| PubChem CID | 68608574 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2R,3S)-3-amino-4-phenyl-1-(pyridin-2-ylmethylamino)butan-2-ol |
| SMILES | N[C@@H](Cc1ccccc1)[C@H](O)CNCc1ccccn1 |
| InChI | InChI=1S/C16H21N3O/c17-15(10-13-6-2-1-3-7-13)16(20)12-18-11-14-8-4-5-9-19-14/h1-9,15-16,18,20H,10-12,17H2/t15-,16+/m0/s1 |
| InChIKey | OVJRULNCLGNRBP-JKSUJKDBSA-N |
| XLogP | 1.10 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |