C18H24N2O2 — CID 68608457
(2R,3S)-3-amino-1-[(4-methoxyphenyl)methylamino]-4-phenylbutan-2-ol (PubChem CID 68608457) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[(4-methoxyphenyl)methylamino]-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[(4-methoxyphenyl)methylamino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 68608457 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2R,3S)-3-amino-1-[(4-methoxyphenyl)methylamino]-4-phenylbutan-2-ol |
| SMILES | COc1ccc(CNC[C@@H](O)[C@@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-22-16-9-7-15(8-10-16)12-20-13-18(21)17(19)11-14-5-3-2-4-6-14/h2-10,17-18,20-21H,11-13,19H2,1H3/t17-,18+/m0/s1 |
| InChIKey | LWQRLWBEETXJJK-ZWKOTPCHSA-N |
| XLogP | 1.72 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |