C18H22N2O3 — CID 142702802
(2R,3S)-3-amino-2-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylbutanamide (PubChem CID 142702802) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2R,3S)-3-amino-2-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylbutanamide.
| Compound Name | (2R,3S)-3-amino-2-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 142702802 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2R,3S)-3-amino-2-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylbutanamide |
| SMILES | COc1ccc(CNC(=O)[C@H](O)[C@@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-23-15-9-7-14(8-10-15)12-20-18(22)17(21)16(19)11-13-5-3-2-4-6-13/h2-10,16-17,21H,11-12,19H2,1H3,(H,20,22)/t16-,17+/m0/s1 |
| InChIKey | GQPKTPOBXCFKJX-DLBZAZTESA-N |
| XLogP | 1.24 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |