C18H21NO4 — CID 10041390
methyl (2S,3S)-3-amino-2-hydroxy-4-(4-phenylmethoxyphenyl)butanoate (PubChem CID 10041390) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl (2S,3S)-3-amino-2-hydroxy-4-(4-phenylmethoxyphenyl)butanoate.
| Compound Name | methyl (2S,3S)-3-amino-2-hydroxy-4-(4-phenylmethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 10041390 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methyl (2S,3S)-3-amino-2-hydroxy-4-(4-phenylmethoxyphenyl)butanoate |
| SMILES | COC(=O)[C@@H](O)[C@@H](N)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-22-18(21)17(20)16(19)11-13-7-9-15(10-8-13)23-12-14-5-3-2-4-6-14/h2-10,16-17,20H,11-12,19H2,1H3/t16-,17-/m0/s1 |
| InChIKey | SAIRTAPYBUMWDK-IRXDYDNUSA-N |
| XLogP | 1.67 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |