C20H28N2O — CID 70090854
4,4-dimethyl-1-(4-phenylmethoxyphenyl)pentane-2,3-diamine (PubChem CID 70090854) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 4,4-dimethyl-1-(4-phenylmethoxyphenyl)pentane-2,3-diamine.
| Compound Name | 4,4-dimethyl-1-(4-phenylmethoxyphenyl)pentane-2,3-diamine |
|---|---|
| PubChem CID | 70090854 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 4,4-dimethyl-1-(4-phenylmethoxyphenyl)pentane-2,3-diamine |
| SMILES | CC(C)(C)C(N)C(N)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H28N2O/c1-20(2,3)19(22)18(21)13-15-9-11-17(12-10-15)23-14-16-7-5-4-6-8-16/h4-12,18-19H,13-14,21-22H2,1-3H3 |
| InChIKey | ADKIGWMUNWBXFC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |