C31H35N3O2 — CID 59131746
(2R,3R)-4-[amino(benzyl)amino]-3-phenylmethoxy-1-(4-phenylmethoxyphenyl)butan-2-amine (PubChem CID 59131746) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is (2R,3R)-4-[amino(benzyl)amino]-3-phenylmethoxy-1-(4-phenylmethoxyphenyl)butan-2-amine.
| Compound Name | (2R,3R)-4-[amino(benzyl)amino]-3-phenylmethoxy-1-(4-phenylmethoxyphenyl)butan-2-amine |
|---|---|
| PubChem CID | 59131746 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | (2R,3R)-4-[amino(benzyl)amino]-3-phenylmethoxy-1-(4-phenylmethoxyphenyl)butan-2-amine |
| SMILES | N[C@H](Cc1ccc(OCc2ccccc2)cc1)[C@@H](CN(N)Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H35N3O2/c32-30(20-25-16-18-29(19-17-25)35-23-27-12-6-2-7-13-27)31(36-24-28-14-8-3-9-15-28)22-34(33)21-26-10-4-1-5-11-26/h1-19,30-31H,20-24,32-33H2/t30-,31-/m1/s1 |
| InChIKey | DRXROIYSJPNORE-FIRIVFDPSA-N |
| XLogP | 5.10 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|