C22H27NO5 — CID 174380677
1-O-(aminomethyl) 3-O-tert-butyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate (PubChem CID 174380677) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-O-(aminomethyl) 3-O-tert-butyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate.
| Compound Name | 1-O-(aminomethyl) 3-O-tert-butyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 174380677 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-O-(aminomethyl) 3-O-tert-butyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccc(OCc2ccccc2)cc1)C(=O)OCN |
| InChI | InChI=1S/C22H27NO5/c1-22(2,3)28-21(25)19(20(24)27-15-23)13-16-9-11-18(12-10-16)26-14-17-7-5-4-6-8-17/h4-12,19H,13-15,23H2,1-3H3 |
| InChIKey | LIASHJUZEQZLNF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|