C30H34O5 — CID 174424237
diethyl 2-[2-benzyl-3-(4-phenylmethoxyphenyl)propyl]propanedioate (PubChem CID 174424237) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is diethyl 2-[2-benzyl-3-(4-phenylmethoxyphenyl)propyl]propanedioate.
| Compound Name | diethyl 2-[2-benzyl-3-(4-phenylmethoxyphenyl)propyl]propanedioate |
|---|---|
| PubChem CID | 174424237 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | diethyl 2-[2-benzyl-3-(4-phenylmethoxyphenyl)propyl]propanedioate |
| SMILES | CCOC(=O)C(CC(Cc1ccccc1)Cc1ccc(OCc2ccccc2)cc1)C(=O)OCC |
| InChI | InChI=1S/C30H34O5/c1-3-33-29(31)28(30(32)34-4-2)21-26(19-23-11-7-5-8-12-23)20-24-15-17-27(18-16-24)35-22-25-13-9-6-10-14-25/h5-18,26,28H,3-4,19-22H2,1-2H3 |
| InChIKey | WRUHXCCPQNNMHP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|