C20H23NO5 — CID 170966374
methyl (2S)-2-[(2-methoxy-2-oxoethyl)amino]-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 170966374) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methoxy-2-oxoethyl)amino]-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[(2-methoxy-2-oxoethyl)amino]-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 170966374 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | methyl (2S)-2-[(2-methoxy-2-oxoethyl)amino]-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | COC(=O)CN[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C20H23NO5/c1-24-19(22)13-21-18(20(23)25-2)12-15-8-10-17(11-9-15)26-14-16-6-4-3-5-7-16/h3-11,18,21H,12-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | XXAJLCPDGOMKFW-SFHVURJKSA-N |
| XLogP | 2.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |