C19H26N2O3 — CID 142662303
(2S)-3-amino-1-[(2,4-dimethoxyphenyl)methylamino]-4-phenylbutan-2-ol (PubChem CID 142662303) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-3-amino-1-[(2,4-dimethoxyphenyl)methylamino]-4-phenylbutan-2-ol.
| Compound Name | (2S)-3-amino-1-[(2,4-dimethoxyphenyl)methylamino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 142662303 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (2S)-3-amino-1-[(2,4-dimethoxyphenyl)methylamino]-4-phenylbutan-2-ol |
| SMILES | COc1ccc(CNC[C@H](O)C(N)Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-23-16-9-8-15(19(11-16)24-2)12-21-13-18(22)17(20)10-14-6-4-3-5-7-14/h3-9,11,17-18,21-22H,10,12-13,20H2,1-2H3/t17?,18-/m0/s1 |
| InChIKey | PDMAPQKXZKKTRF-ZVAWYAOSSA-N |
| XLogP | 1.72 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |