C23H26N2O2 — CID 67729247
N'-[(2,4-dimethoxyphenyl)methyl]-1,1-diphenylethane-1,2-diamine (PubChem CID 67729247) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N'-[(2,4-dimethoxyphenyl)methyl]-1,1-diphenylethane-1,2-diamine.
| Compound Name | N'-[(2,4-dimethoxyphenyl)methyl]-1,1-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 67729247 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N'-[(2,4-dimethoxyphenyl)methyl]-1,1-diphenylethane-1,2-diamine |
| SMILES | COc1ccc(CNCC(N)(c2ccccc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H26N2O2/c1-26-21-14-13-18(22(15-21)27-2)16-25-17-23(24,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-15,25H,16-17,24H2,1-2H3 |
| InChIKey | HHSZQUZGGBBMSB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |