C21H30N2O — CID 59569831
(2R,3S)-3-amino-1-[(3-tert-butylphenyl)methylamino]-4-phenylbutan-2-ol (PubChem CID 59569831) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[(3-tert-butylphenyl)methylamino]-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[(3-tert-butylphenyl)methylamino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 59569831 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (2R,3S)-3-amino-1-[(3-tert-butylphenyl)methylamino]-4-phenylbutan-2-ol |
| SMILES | CC(C)(C)c1cccc(CNC[C@@H](O)[C@@H](N)Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H30N2O/c1-21(2,3)18-11-7-10-17(12-18)14-23-15-20(24)19(22)13-16-8-5-4-6-9-16/h4-12,19-20,23-24H,13-15,22H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | LUYIBFONCYAYTR-VQTJNVASSA-N |
| XLogP | 3.00 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |