C20H28N2O — CID 68887734
(2S,3R)-2-amino-5-[(4-ethylphenyl)methylamino]-1-phenylpentan-3-ol (PubChem CID 68887734) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is (2S,3R)-2-amino-5-[(4-ethylphenyl)methylamino]-1-phenylpentan-3-ol.
| Compound Name | (2S,3R)-2-amino-5-[(4-ethylphenyl)methylamino]-1-phenylpentan-3-ol |
|---|---|
| PubChem CID | 68887734 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (2S,3R)-2-amino-5-[(4-ethylphenyl)methylamino]-1-phenylpentan-3-ol |
| SMILES | CCc1ccc(CNCC[C@@H](O)[C@@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H28N2O/c1-2-16-8-10-18(11-9-16)15-22-13-12-20(23)19(21)14-17-6-4-3-5-7-17/h3-11,19-20,22-23H,2,12-15,21H2,1H3/t19-,20+/m0/s1 |
| InChIKey | UTFXURZISFVPEA-VQTJNVASSA-N |
| XLogP | 2.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|