C12H19NO3 — CID 22804690
(2S,3S)-5-(benzylamino)pentane-1,2,3-triol (PubChem CID 22804690) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (2S,3S)-5-(benzylamino)pentane-1,2,3-triol.
| Compound Name | (2S,3S)-5-(benzylamino)pentane-1,2,3-triol |
|---|---|
| PubChem CID | 22804690 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (2S,3S)-5-(benzylamino)pentane-1,2,3-triol |
| SMILES | OC[C@H](O)[C@@H](O)CCNCc1ccccc1 |
| InChI | InChI=1S/C12H19NO3/c14-9-12(16)11(15)6-7-13-8-10-4-2-1-3-5-10/h1-5,11-16H,6-9H2/t11-,12-/m0/s1 |
| InChIKey | LUILFIVRPCRYDH-RYUDHWBXSA-N |
| XLogP | -0.12 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|