C15H26N2O2 — CID 143664363
2-amino-4-(benzylamino)butanoic acid;2-methylpropane (PubChem CID 143664363) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-amino-4-(benzylamino)butanoic acid;2-methylpropane.
| Compound Name | 2-amino-4-(benzylamino)butanoic acid;2-methylpropane |
|---|---|
| PubChem CID | 143664363 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-amino-4-(benzylamino)butanoic acid;2-methylpropane |
| SMILES | CC(C)C.NC(CCNCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H16N2O2.C4H10/c12-10(11(14)15)6-7-13-8-9-4-2-1-3-5-9;1-4(2)3/h1-5,10,13H,6-8,12H2,(H,14,15);4H,1-3H3 |
| InChIKey | JHFIAVSNMFMEGC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|