C14H22N2O4 — CID 70255387
(2S)-2-amino-4-methylpentanoic acid;benzylcarbamic acid (PubChem CID 70255387) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentanoic acid;benzylcarbamic acid.
| Compound Name | (2S)-2-amino-4-methylpentanoic acid;benzylcarbamic acid |
|---|---|
| PubChem CID | 70255387 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2S)-2-amino-4-methylpentanoic acid;benzylcarbamic acid |
| SMILES | CC(C)C[C@H](N)C(=O)O.O=C(O)NCc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C6H13NO2/c10-8(11)9-6-7-4-2-1-3-5-7;1-4(2)3-5(7)6(8)9/h1-5,9H,6H2,(H,10,11);4-5H,3,7H2,1-2H3,(H,8,9)/t;5-/m.0/s1 |
| InChIKey | DJHSYKYKMMKCKK-ZSCHJXSPSA-N |
| XLogP | 1.90 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |