C20H27NO3 — CID 70097248
(2S)-2-amino-4-methylpentanoic acid;phenylmethoxymethylbenzene (PubChem CID 70097248) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentanoic acid;phenylmethoxymethylbenzene.
| Compound Name | (2S)-2-amino-4-methylpentanoic acid;phenylmethoxymethylbenzene |
|---|---|
| PubChem CID | 70097248 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (2S)-2-amino-4-methylpentanoic acid;phenylmethoxymethylbenzene |
| SMILES | CC(C)C[C@H](N)C(=O)O.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.C6H13NO2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-4(2)3-5(7)6(8)9/h1-10H,11-12H2;4-5H,3,7H2,1-2H3,(H,8,9)/t;5-/m.0/s1 |
| InChIKey | ZZTGAOMDKNSNFE-ZSCHJXSPSA-N |
| XLogP | 3.85 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |