C17H29N3O6 — CID 22323802
2-aminoacetic acid;2-amino-4-methylpentanoic acid;2-amino-3-phenylpropanoic acid (PubChem CID 22323802) has the molecular formula C17H29N3O6 and a molecular weight of 371.43 g/mol. Its IUPAC name is 2-aminoacetic acid;2-amino-4-methylpentanoic acid;2-amino-3-phenylpropanoic acid.
| Compound Name | 2-aminoacetic acid;2-amino-4-methylpentanoic acid;2-amino-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22323802 |
| Molecular Formula | C17H29N3O6 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-aminoacetic acid;2-amino-4-methylpentanoic acid;2-amino-3-phenylpropanoic acid |
| SMILES | CC(C)CC(N)C(=O)O.NC(Cc1ccccc1)C(=O)O.NCC(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H13NO2.C2H5NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-4(2)3-5(7)6(8)9;3-1-2(4)5/h1-5,8H,6,10H2,(H,11,12);4-5H,3,7H2,1-2H3,(H,8,9);1,3H2,(H,4,5) |
| InChIKey | XCDJMQRPMLFIHY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |