C16H24N2O3 — CID 16742166
benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]propanoate (PubChem CID 16742166) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 16742166 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]propanoate |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H24N2O3/c1-11(2)9-14(17)15(19)18-12(3)16(20)21-10-13-7-5-4-6-8-13/h4-8,11-12,14H,9-10,17H2,1-3H3,(H,18,19)/t12-,14-/m0/s1 |
| InChIKey | RFVHPRUCNKWTBS-JSGCOSHPSA-N |
| XLogP | 1.61 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |