C17H24F2N2O4 — CID 90060627
benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(difluoromethoxy)propanoate (PubChem CID 90060627) has the molecular formula C17H24F2N2O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(difluoromethoxy)propanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(difluoromethoxy)propanoate |
|---|---|
| PubChem CID | 90060627 |
| Molecular Formula | C17H24F2N2O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(difluoromethoxy)propanoate |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](COC(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24F2N2O4/c1-11(2)8-13(20)15(22)21-14(10-25-17(18)19)16(23)24-9-12-6-4-3-5-7-12/h3-7,11,13-14,17H,8-10,20H2,1-2H3,(H,21,22)/t13-,14-/m0/s1 |
| InChIKey | UZPHUKQSNDMKMV-KBPBESRZSA-N |
| XLogP | 1.83 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |