C16H25ClN2O3 — CID 52993176
methyl 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoate;hydrochloride (PubChem CID 52993176) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is methyl 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoate;hydrochloride.
| Compound Name | methyl 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 52993176 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | methyl 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoate;hydrochloride |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(N)CC(C)C.Cl |
| InChI | InChI=1S/C16H24N2O3.ClH/c1-11(2)9-13(17)15(19)18-14(16(20)21-3)10-12-7-5-4-6-8-12;/h4-8,11,13-14H,9-10,17H2,1-3H3,(H,18,19);1H |
| InChIKey | ZFDDNDZIYSOTHW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |