C17H26N2O4 — CID 174902616
methyl 2-[(2-amino-4-methylpentanoyl)amino]-3-(3-methoxyphenyl)propanoate (PubChem CID 174902616) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 2-[(2-amino-4-methylpentanoyl)amino]-3-(3-methoxyphenyl)propanoate.
| Compound Name | methyl 2-[(2-amino-4-methylpentanoyl)amino]-3-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 174902616 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | methyl 2-[(2-amino-4-methylpentanoyl)amino]-3-(3-methoxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1cccc(OC)c1)NC(=O)C(N)CC(C)C |
| InChI | InChI=1S/C17H26N2O4/c1-11(2)8-14(18)16(20)19-15(17(21)23-4)10-12-6-5-7-13(9-12)22-3/h5-7,9,11,14-15H,8,10,18H2,1-4H3,(H,19,20) |
| InChIKey | DEKMPNSHEZOPMU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |