C16H24N2O4 — CID 7640872
methyl (2R)-2-[(3-methoxyphenyl)methylcarbamoylamino]-4-methylpentanoate (PubChem CID 7640872) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl (2R)-2-[(3-methoxyphenyl)methylcarbamoylamino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[(3-methoxyphenyl)methylcarbamoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 7640872 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | methyl (2R)-2-[(3-methoxyphenyl)methylcarbamoylamino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)NCc1cccc(OC)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-11(2)8-14(15(19)22-4)18-16(20)17-10-12-6-5-7-13(9-12)21-3/h5-7,9,11,14H,8,10H2,1-4H3,(H2,17,18,20)/t14-/m1/s1 |
| InChIKey | MIOZSTBGAJHFJJ-CQSZACIVSA-N |
| XLogP | 2.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |