C12H15N2O4- — CID 7529441
(2S)-2-[(3-methoxyphenyl)methylcarbamoylamino]propanoate (PubChem CID 7529441) has the molecular formula C12H15N2O4- and a molecular weight of 251.26 g/mol. Its IUPAC name is (2S)-2-[(3-methoxyphenyl)methylcarbamoylamino]propanoate.
| Compound Name | (2S)-2-[(3-methoxyphenyl)methylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 7529441 |
| Molecular Formula | C12H15N2O4- |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (2S)-2-[(3-methoxyphenyl)methylcarbamoylamino]propanoate |
| SMILES | COc1cccc(CNC(=O)N[C@@H](C)C(=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O4/c1-8(11(15)16)14-12(17)13-7-9-4-3-5-10(6-9)18-2/h3-6,8H,7H2,1-2H3,(H,15,16)(H2,13,14,17)/p-1/t8-/m0/s1 |
| InChIKey | MELCXBFLNWYNSP-QMMMGPOBSA-M |
| XLogP | -0.37 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |