C15H23N3O5S — CID 2005630
methyl (2S)-4-methyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]pentanoate (PubChem CID 2005630) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]pentanoate |
|---|---|
| PubChem CID | 2005630 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | methyl (2S)-4-methyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23N3O5S/c1-10(2)8-13(14(19)23-3)18-15(20)17-9-11-4-6-12(7-5-11)24(16,21)22/h4-7,10,13H,8-9H2,1-3H3,(H2,16,21,22)(H2,17,18,20)/t13-/m0/s1 |
| InChIKey | UOHACVZJACFSPI-ZDUSSCGKSA-N |
| XLogP | 0.72 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |