C15H23N3O5S — CID 51432316
methyl (2R,3R)-3-methyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]pentanoate (PubChem CID 51432316) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is methyl (2R,3R)-3-methyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]pentanoate.
| Compound Name | methyl (2R,3R)-3-methyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]pentanoate |
|---|---|
| PubChem CID | 51432316 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | methyl (2R,3R)-3-methyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]pentanoate |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)NCc1ccc(S(N)(=O)=O)cc1)C(=O)OC |
| InChI | InChI=1S/C15H23N3O5S/c1-4-10(2)13(14(19)23-3)18-15(20)17-9-11-5-7-12(8-6-11)24(16,21)22/h5-8,10,13H,4,9H2,1-3H3,(H2,16,21,22)(H2,17,18,20)/t10-,13-/m1/s1 |
| InChIKey | KRACPILRQKWXJU-ZWNOBZJWSA-N |
| XLogP | 0.72 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |