C14H19N2O3- — CID 7177499
(2S,3R)-2-(benzylcarbamoylamino)-3-methylpentanoate (PubChem CID 7177499) has the molecular formula C14H19N2O3- and a molecular weight of 263.32 g/mol. Its IUPAC name is (2S,3R)-2-(benzylcarbamoylamino)-3-methylpentanoate.
| Compound Name | (2S,3R)-2-(benzylcarbamoylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 7177499 |
| Molecular Formula | C14H19N2O3- |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (2S,3R)-2-(benzylcarbamoylamino)-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)NCc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C14H20N2O3/c1-3-10(2)12(13(17)18)16-14(19)15-9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,17,18)(H2,15,16,19)/p-1/t10-,12+/m1/s1 |
| InChIKey | CXWLDMYMSFWKKP-PWSUYJOCSA-M |
| XLogP | 0.65 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |