C11H16N2O2 — CID 94035272
1-benzyl-3-[(2R)-1-hydroxypropan-2-yl]urea (PubChem CID 94035272) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-benzyl-3-[(2R)-1-hydroxypropan-2-yl]urea.
| Compound Name | 1-benzyl-3-[(2R)-1-hydroxypropan-2-yl]urea |
|---|---|
| PubChem CID | 94035272 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-benzyl-3-[(2R)-1-hydroxypropan-2-yl]urea |
| SMILES | C[C@H](CO)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H16N2O2/c1-9(8-14)13-11(15)12-7-10-5-3-2-4-6-10/h2-6,9,14H,7-8H2,1H3,(H2,12,13,15)/t9-/m1/s1 |
| InChIKey | GHGTZYMWSFHIAY-SECBINFHSA-N |
| XLogP | 0.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |