C14H18N4O2 — CID 94029140
1-[(2R)-1-hydroxypropan-2-yl]-3-[(1-phenylpyrazol-4-yl)methyl]urea (PubChem CID 94029140) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxypropan-2-yl]-3-[(1-phenylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-[(2R)-1-hydroxypropan-2-yl]-3-[(1-phenylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 94029140 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-[(2R)-1-hydroxypropan-2-yl]-3-[(1-phenylpyrazol-4-yl)methyl]urea |
| SMILES | C[C@H](CO)NC(=O)NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H18N4O2/c1-11(10-19)17-14(20)15-7-12-8-16-18(9-12)13-5-3-2-4-6-13/h2-6,8-9,11,19H,7,10H2,1H3,(H2,15,17,20)/t11-/m1/s1 |
| InChIKey | WYMWIYDQQCIWQC-LLVKDONJSA-N |
| XLogP | 1.05 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |