C20H19ClN8O — CID 86969996
1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[1-(1-phenyltetrazol-5-yl)ethyl]urea (PubChem CID 86969996) has the molecular formula C20H19ClN8O and a molecular weight of 422.88 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[1-(1-phenyltetrazol-5-yl)ethyl]urea.
| Compound Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[1-(1-phenyltetrazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 86969996 |
| Molecular Formula | C20H19ClN8O |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[1-(1-phenyltetrazol-5-yl)ethyl]urea |
| SMILES | CC(NC(=O)NCc1cnn(-c2ccc(Cl)cc2)c1)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C20H19ClN8O/c1-14(19-25-26-27-29(19)18-5-3-2-4-6-18)24-20(30)22-11-15-12-23-28(13-15)17-9-7-16(21)8-10-17/h2-10,12-14H,11H2,1H3,(H2,22,24,30) |
| InChIKey | CZTPLGWNRJVPMZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |