C21H18ClN5O — CID 86968538
N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 86968538) has the molecular formula C21H18ClN5O and a molecular weight of 391.86 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86968538 |
| Molecular Formula | C21H18ClN5O |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)cc1C(=O)NCc1cnn(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H18ClN5O/c1-15-20(14-27(25-15)18-5-3-2-4-6-18)21(28)23-11-16-12-24-26(13-16)19-9-7-17(22)8-10-19/h2-10,12-14H,11H2,1H3,(H,23,28) |
| InChIKey | ZMQSIKGIUYTUKC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |