C17H13BrClN3O — CID 134036052
5-bromo-2-chloro-N-[(1-phenylpyrazol-4-yl)methyl]benzamide (PubChem CID 134036052) has the molecular formula C17H13BrClN3O and a molecular weight of 390.67 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(1-phenylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 134036052 |
| Molecular Formula | C17H13BrClN3O |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 5-bromo-2-chloro-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1cnn(-c2ccccc2)c1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C17H13BrClN3O/c18-13-6-7-16(19)15(8-13)17(23)20-9-12-10-21-22(11-12)14-4-2-1-3-5-14/h1-8,10-11H,9H2,(H,20,23) |
| InChIKey | NKFLJKFOHZJNGE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |