C17H12Cl3N3O2 — CID 112821059
2,3,5-trichloro-6-hydroxy-N-[(1-phenylpyrazol-4-yl)methyl]benzamide (PubChem CID 112821059) has the molecular formula C17H12Cl3N3O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-[(1-phenylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 112821059 |
| Molecular Formula | C17H12Cl3N3O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1cnn(-c2ccccc2)c1)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C17H12Cl3N3O2/c18-12-6-13(19)16(24)14(15(12)20)17(25)21-7-10-8-22-23(9-10)11-4-2-1-3-5-11/h1-6,8-9,24H,7H2,(H,21,25) |
| InChIKey | HLLXERYDGWTCCZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|