C18H14Cl3N3O2 — CID 112813676
2,3,5-trichloro-6-hydroxy-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide (PubChem CID 112813676) has the molecular formula C18H14Cl3N3O2 and a molecular weight of 410.69 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 112813676 |
| Molecular Formula | C18H14Cl3N3O2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)C(=O)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl3N3O2/c1-23(18(26)15-16(21)13(19)7-14(20)17(15)25)9-11-8-22-24(10-11)12-5-3-2-4-6-12/h2-8,10,25H,9H2,1H3 |
| InChIKey | FAYCXPMNIUYKHI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|