C19H19N3O2 — CID 51237804
2-hydroxy-N,5-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide (PubChem CID 51237804) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-hydroxy-N,5-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 2-hydroxy-N,5-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 51237804 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-hydroxy-N,5-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
| SMILES | Cc1ccc(O)c(C(=O)N(C)Cc2cnn(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C19H19N3O2/c1-14-8-9-18(23)17(10-14)19(24)21(2)12-15-11-20-22(13-15)16-6-4-3-5-7-16/h3-11,13,23H,12H2,1-2H3 |
| InChIKey | DZMRXGMVWNMFBI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |